C13H29N3O — CID 144974845
N-(2-amino-4-methylpent-1-en-3-yl)-N-methylacetamide;N-methylpropan-1-amine (PubChem CID 144974845) has the molecular formula C13H29N3O and a molecular weight of 243.39 g/mol. Its IUPAC name is N-(2-amino-4-methylpent-1-en-3-yl)-N-methylacetamide;N-methylpropan-1-amine.
| Compound Name | N-(2-amino-4-methylpent-1-en-3-yl)-N-methylacetamide;N-methylpropan-1-amine |
|---|---|
| PubChem CID | 144974845 |
| Molecular Formula | C13H29N3O |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.23 |
| IUPAC Name | N-(2-amino-4-methylpent-1-en-3-yl)-N-methylacetamide;N-methylpropan-1-amine |
| SMILES | C=C(N)C(C(C)C)N(C)C(C)=O.CCCNC |
| InChI | InChI=1S/C9H18N2O.C4H11N/c1-6(2)9(7(3)10)11(5)8(4)12;1-3-4-5-2/h6,9H,3,10H2,1-2,4-5H3;5H,3-4H2,1-2H3 |
| InChIKey | FFJREVAZPBRJAL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |