C8H24N2O4S — CID 174472980
N,N-dimethylmethanamine;methyl hydrogen sulfate;N-methylpropan-1-amine (PubChem CID 174472980) has the molecular formula C8H24N2O4S and a molecular weight of 244.36 g/mol. Its IUPAC name is N,N-dimethylmethanamine;methyl hydrogen sulfate;N-methylpropan-1-amine.
| Compound Name | N,N-dimethylmethanamine;methyl hydrogen sulfate;N-methylpropan-1-amine |
|---|---|
| PubChem CID | 174472980 |
| Molecular Formula | C8H24N2O4S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | N,N-dimethylmethanamine;methyl hydrogen sulfate;N-methylpropan-1-amine |
| SMILES | CCCNC.CN(C)C.COS(=O)(=O)O |
| InChI | InChI=1S/C4H11N.C3H9N.CH4O4S/c1-3-4-5-2;1-4(2)3;1-5-6(2,3)4/h5H,3-4H2,1-2H3;1-3H3;1H3,(H,2,3,4) |
| InChIKey | KLQLZVZJTHZENS-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|