About N-[3-(methylamino)propyl]octadecanamide;methyl hydrogen sulfate
N-[3-(methylamino)propyl]octadecanamide;methyl hydrogen sulfate (PubChem CID 174942610) has the molecular formula C23H50N2O5S
and a molecular weight of 466.73 g/mol. Its IUPAC name is N-[3-(methylamino)propyl]octadecanamide;methyl hydrogen sulfate.
Molecular Properties
| Compound Name | N-[3-(methylamino)propyl]octadecanamide;methyl hydrogen sulfate |
| PubChem CID | 174942610 |
| Molecular Formula | C23H50N2O5S |
| Molecular Weight | 466.73 g/mol |
| Exact Mass | 466.34 |
| IUPAC Name | N-[3-(methylamino)propyl]octadecanamide;methyl hydrogen sulfate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)NCCCNC.COS(=O)(=O)O |
| InChI | InChI=1S/C22H46N2O.CH4O4S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-22(25)24-21-18-20-23-2;1-5-6(2,3)4/h23H,3-21H2,1-2H3,(H,24,25);1H3,(H,2,3,4) |
| InChIKey | NNDZLHILRKXHSP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.73 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(methylamino)propyl]octadecanamide;methyl hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(methylamino)propyl]octadecanamide;methyl hydrogen sulfate?
The IUPAC name of N-[3-(methylamino)propyl]octadecanamide;methyl hydrogen sulfate (CID 174942610) is N-[3-(methylamino)propyl]octadecanamide;methyl hydrogen sulfate.
What is the SMILES notation for N-[3-(methylamino)propyl]octadecanamide;methyl hydrogen sulfate?
The canonical SMILES for N-[3-(methylamino)propyl]octadecanamide;methyl hydrogen sulfate is CCCCCCCCCCCCCCCCCC(=O)NCCCNC.COS(=O)(=O)O.
What is the InChIKey of N-[3-(methylamino)propyl]octadecanamide;methyl hydrogen sulfate?
The InChIKey is NNDZLHILRKXHSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H46N2O.CH4O4S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-22(25)24-21-18-20-23-2;1-5-6(2,3)4/h23H,3-21H2,1-2H3,(H,24,25);1H3,(H,2,3,4).
What are the key properties of N-[3-(methylamino)propyl]octadecanamide;methyl hydrogen sulfate?
N-[3-(methylamino)propyl]octadecanamide;methyl hydrogen sulfate has a molecular weight of 466.73 g/mol, XLogP of 5.41, 21 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(methylamino)propyl]octadecanamide;methyl hydrogen sulfate is sourced from PubChem (CID 174942610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).