About N-methylpropan-1-amine;6-oxoheptanamide
N-methylpropan-1-amine;6-oxoheptanamide (PubChem CID 142298315) has the molecular formula C11H24N2O2
and a molecular weight of 216.32 g/mol. Its IUPAC name is N-methylpropan-1-amine;6-oxoheptanamide.
Molecular Properties
| Compound Name | N-methylpropan-1-amine;6-oxoheptanamide |
| PubChem CID | 142298315 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | N-methylpropan-1-amine;6-oxoheptanamide |
| SMILES | CC(=O)CCCCC(N)=O.CCCNC |
| InChI | InChI=1S/C7H13NO2.C4H11N/c1-6(9)4-2-3-5-7(8)10;1-3-4-5-2/h2-5H2,1H3,(H2,8,10);5H,3-4H2,1-2H3 |
| InChIKey | MPLHEWQSIIRHOU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methylpropan-1-amine;6-oxoheptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylpropan-1-amine;6-oxoheptanamide?
The IUPAC name of N-methylpropan-1-amine;6-oxoheptanamide (CID 142298315) is N-methylpropan-1-amine;6-oxoheptanamide.
What is the SMILES notation for N-methylpropan-1-amine;6-oxoheptanamide?
The canonical SMILES for N-methylpropan-1-amine;6-oxoheptanamide is CC(=O)CCCCC(N)=O.CCCNC.
What is the InChIKey of N-methylpropan-1-amine;6-oxoheptanamide?
The InChIKey is MPLHEWQSIIRHOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.C4H11N/c1-6(9)4-2-3-5-7(8)10;1-3-4-5-2/h2-5H2,1H3,(H2,8,10);5H,3-4H2,1-2H3.
What are the key properties of N-methylpropan-1-amine;6-oxoheptanamide?
N-methylpropan-1-amine;6-oxoheptanamide has a molecular weight of 216.32 g/mol, XLogP of 1.24, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylpropan-1-amine;6-oxoheptanamide is sourced from PubChem (CID 142298315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).