About N-methyldodecan-1-amine;octadec-9-enamide
N-methyldodecan-1-amine;octadec-9-enamide (PubChem CID 173334466) has the molecular formula C31H64N2O
and a molecular weight of 480.87 g/mol. Its IUPAC name is N-methyldodecan-1-amine;octadec-9-enamide.
Molecular Properties
| Compound Name | N-methyldodecan-1-amine;octadec-9-enamide |
| PubChem CID | 173334466 |
| Molecular Formula | C31H64N2O |
| Molecular Weight | 480.87 g/mol |
| Exact Mass | 480.50 |
| IUPAC Name | N-methyldodecan-1-amine;octadec-9-enamide |
| SMILES | CCCCCCCCC=CCCCCCCCC(N)=O.CCCCCCCCCCCCNC |
| InChI | InChI=1S/C18H35NO.C13H29N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-4-5-6-7-8-9-10-11-12-13-14-2/h9-10H,2-8,11-17H2,1H3,(H2,19,20);14H,3-13H2,1-2H3 |
| InChIKey | IGBVANHYHUEHHE-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.87 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-methyldodecan-1-amine;octadec-9-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyldodecan-1-amine;octadec-9-enamide?
The IUPAC name of N-methyldodecan-1-amine;octadec-9-enamide (CID 173334466) is N-methyldodecan-1-amine;octadec-9-enamide.
What is the SMILES notation for N-methyldodecan-1-amine;octadec-9-enamide?
The canonical SMILES for N-methyldodecan-1-amine;octadec-9-enamide is CCCCCCCCC=CCCCCCCCC(N)=O.CCCCCCCCCCCCNC.
What is the InChIKey of N-methyldodecan-1-amine;octadec-9-enamide?
The InChIKey is IGBVANHYHUEHHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35NO.C13H29N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-4-5-6-7-8-9-10-11-12-13-14-2/h9-10H,2-8,11-17H2,1H3,(H2,19,20);14H,3-13H2,1-2H3.
What are the key properties of N-methyldodecan-1-amine;octadec-9-enamide?
N-methyldodecan-1-amine;octadec-9-enamide has a molecular weight of 480.87 g/mol, XLogP of 9.64, 26 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyldodecan-1-amine;octadec-9-enamide is sourced from PubChem (CID 173334466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).