C26H52N2O4 — CID 123967487
7-(methylamino)heptan-2-one;1-(methylamino)propan-2-one;tetradecane-2,13-dione (PubChem CID 123967487) has the molecular formula C26H52N2O4 and a molecular weight of 456.71 g/mol. Its IUPAC name is 7-(methylamino)heptan-2-one;1-(methylamino)propan-2-one;tetradecane-2,13-dione.
| Compound Name | 7-(methylamino)heptan-2-one;1-(methylamino)propan-2-one;tetradecane-2,13-dione |
|---|---|
| PubChem CID | 123967487 |
| Molecular Formula | C26H52N2O4 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.39 |
| IUPAC Name | 7-(methylamino)heptan-2-one;1-(methylamino)propan-2-one;tetradecane-2,13-dione |
| SMILES | CC(=O)CCCCCCCCCCC(C)=O.CNCC(C)=O.CNCCCCCC(C)=O |
| InChI | InChI=1S/C14H26O2.C8H17NO.C4H9NO/c1-13(15)11-9-7-5-3-4-6-8-10-12-14(2)16;1-8(10)6-4-3-5-7-9-2;1-4(6)3-5-2/h3-12H2,1-2H3;9H,3-7H2,1-2H3;5H,3H2,1-2H3 |
| InChIKey | BTDVRTMLWXMHCJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|