About methane;12-(methylamino)dodecan-2-one;propane
methane;12-(methylamino)dodecan-2-one;propane (PubChem CID 158218512) has the molecular formula C42H131NO
and a molecular weight of 666.52 g/mol. Its IUPAC name is methane;12-(methylamino)dodecan-2-one;propane.
Molecular Properties
| Compound Name | methane;12-(methylamino)dodecan-2-one;propane |
| PubChem CID | 158218512 |
| Molecular Formula | C42H131NO |
| Molecular Weight | 666.52 g/mol |
| Exact Mass | 666.02 |
| IUPAC Name | methane;12-(methylamino)dodecan-2-one;propane |
| SMILES | C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.CCC.CCC.CCC.CNCCCCCCCCCCC(C)=O |
| InChI | InChI=1S/C13H27NO.3C3H8.20CH4/c1-13(15)11-9-7-5-3-4-6-8-10-12-14-2;3*1-3-2;;;;;;;;;;;;;;;;;;;;/h14H,3-12H2,1-2H3;3*3H2,1-2H3;20*1H4 |
| InChIKey | GCYNYYYVZSRAJH-UHFFFAOYSA-N |
| XLogP | 20.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 666.52 |
| LogP ≤ 5 | 20.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methane;12-(methylamino)dodecan-2-one;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;12-(methylamino)dodecan-2-one;propane?
The IUPAC name of methane;12-(methylamino)dodecan-2-one;propane (CID 158218512) is methane;12-(methylamino)dodecan-2-one;propane.
What is the SMILES notation for methane;12-(methylamino)dodecan-2-one;propane?
The canonical SMILES for methane;12-(methylamino)dodecan-2-one;propane is C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.C.CCC.CCC.CCC.CNCCCCCCCCCCC(C)=O.
What is the InChIKey of methane;12-(methylamino)dodecan-2-one;propane?
The InChIKey is GCYNYYYVZSRAJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO.3C3H8.20CH4/c1-13(15)11-9-7-5-3-4-6-8-10-12-14-2;3*1-3-2;;;;;;;;;;;;;;;;;;;;/h14H,3-12H2,1-2H3;3*3H2,1-2H3;20*1H4.
What are the key properties of methane;12-(methylamino)dodecan-2-one;propane?
methane;12-(methylamino)dodecan-2-one;propane has a molecular weight of 666.52 g/mol, XLogP of 20.28, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;12-(methylamino)dodecan-2-one;propane is sourced from PubChem (CID 158218512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).