C13H24O4Si — CID 12035786
ethyl (4R,5R)-5-methyl-3-oxo-4-trimethylsilyloxyhept-6-enoate (PubChem CID 12035786) has the molecular formula C13H24O4Si and a molecular weight of 272.42 g/mol. Its IUPAC name is ethyl (4R,5R)-5-methyl-3-oxo-4-trimethylsilyloxyhept-6-enoate.
| Compound Name | ethyl (4R,5R)-5-methyl-3-oxo-4-trimethylsilyloxyhept-6-enoate |
|---|---|
| PubChem CID | 12035786 |
| Molecular Formula | C13H24O4Si |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | ethyl (4R,5R)-5-methyl-3-oxo-4-trimethylsilyloxyhept-6-enoate |
| SMILES | C=C[C@@H](C)[C@@H](O[Si](C)(C)C)C(=O)CC(=O)OCC |
| InChI | InChI=1S/C13H24O4Si/c1-7-10(3)13(17-18(4,5)6)11(14)9-12(15)16-8-2/h7,10,13H,1,8-9H2,2-6H3/t10-,13-/m1/s1 |
| InChIKey | QEMYEEHMQMMEQG-ZWNOBZJWSA-N |
| XLogP | 2.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|