C22H48OSi3 — CID 135068617
triethyl-[(4E)-6-triethylsilyloxy-7-trimethylsilylhepta-1,4-dien-4-yl]silane (PubChem CID 135068617) has the molecular formula C22H48OSi3 and a molecular weight of 412.88 g/mol. Its IUPAC name is triethyl-[(4E)-6-triethylsilyloxy-7-trimethylsilylhepta-1,4-dien-4-yl]silane.
| Compound Name | triethyl-[(4E)-6-triethylsilyloxy-7-trimethylsilylhepta-1,4-dien-4-yl]silane |
|---|---|
| PubChem CID | 135068617 |
| Molecular Formula | C22H48OSi3 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | triethyl-[(4E)-6-triethylsilyloxy-7-trimethylsilylhepta-1,4-dien-4-yl]silane |
| SMILES | C=CC/C(=C\C(C[Si](C)(C)C)O[Si](CC)(CC)CC)[Si](CC)(CC)CC |
| InChI | InChI=1S/C22H48OSi3/c1-11-18-22(25(12-2,13-3)14-4)19-21(20-24(8,9)10)23-26(15-5,16-6)17-7/h11,19,21H,1,12-18,20H2,2-10H3/b22-19+ |
| InChIKey | AKZYFAMHFNSXLF-ZBJSNUHESA-N |
| XLogP | 8.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|