C14H32O3Si2 — CID 11044938
triethyl-[(E,2R)-4-methoxy-4-trimethylsilyloxybut-3-en-2-yl]oxysilane (PubChem CID 11044938) has the molecular formula C14H32O3Si2 and a molecular weight of 304.58 g/mol. Its IUPAC name is triethyl-[(E,2R)-4-methoxy-4-trimethylsilyloxybut-3-en-2-yl]oxysilane.
| Compound Name | triethyl-[(E,2R)-4-methoxy-4-trimethylsilyloxybut-3-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 11044938 |
| Molecular Formula | C14H32O3Si2 |
| Molecular Weight | 304.58 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | triethyl-[(E,2R)-4-methoxy-4-trimethylsilyloxybut-3-en-2-yl]oxysilane |
| SMILES | CC[Si](CC)(CC)O[C@H](C)/C=C(\OC)O[Si](C)(C)C |
| InChI | InChI=1S/C14H32O3Si2/c1-9-19(10-2,11-3)16-13(4)12-14(15-5)17-18(6,7)8/h12-13H,9-11H2,1-8H3/b14-12+/t13-/m1/s1 |
| InChIKey | ZUMLHVWIRRMETC-MNWMYKRDSA-N |
| XLogP | 4.74 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.58 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|