C18H34O6Si — CID 59044998
dimethyl 4-[(Z)-4-methoxy-4-trimethylsilyloxybut-3-en-2-yl]-2,2,3-trimethylpentanedioate (PubChem CID 59044998) has the molecular formula C18H34O6Si and a molecular weight of 374.55 g/mol. Its IUPAC name is dimethyl 4-[(Z)-4-methoxy-4-trimethylsilyloxybut-3-en-2-yl]-2,2,3-trimethylpentanedioate.
| Compound Name | dimethyl 4-[(Z)-4-methoxy-4-trimethylsilyloxybut-3-en-2-yl]-2,2,3-trimethylpentanedioate |
|---|---|
| PubChem CID | 59044998 |
| Molecular Formula | C18H34O6Si |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | dimethyl 4-[(Z)-4-methoxy-4-trimethylsilyloxybut-3-en-2-yl]-2,2,3-trimethylpentanedioate |
| SMILES | COC(=O)C(C(C)/C=C(/OC)O[Si](C)(C)C)C(C)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C18H34O6Si/c1-12(11-14(21-5)24-25(8,9)10)15(16(19)22-6)13(2)18(3,4)17(20)23-7/h11-13,15H,1-10H3/b14-11- |
| InChIKey | PVSFEEOTOSCWHQ-KAMYIIQDSA-N |
| XLogP | 3.59 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|