C17H17Cl2NO2 — CID 59138668
methyl 3-(5,6-dichloro-3-pyridinyl)-2,2-dimethyl-3-phenylpropanoate (PubChem CID 59138668) has the molecular formula C17H17Cl2NO2 and a molecular weight of 338.23 g/mol. Its IUPAC name is methyl 3-(5,6-dichloro-3-pyridinyl)-2,2-dimethyl-3-phenylpropanoate.
| Compound Name | methyl 3-(5,6-dichloro-3-pyridinyl)-2,2-dimethyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 59138668 |
| Molecular Formula | C17H17Cl2NO2 |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | methyl 3-(5,6-dichloro-3-pyridinyl)-2,2-dimethyl-3-phenylpropanoate |
| SMILES | COC(=O)C(C)(C)C(c1ccccc1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2NO2/c1-17(2,16(21)22-3)14(11-7-5-4-6-8-11)12-9-13(18)15(19)20-10-12/h4-10,14H,1-3H3 |
| InChIKey | NDAKSUUZAKCANE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|