C20H32O2Si — CID 101122467
methyl (E)-5-[tert-butyl(dimethyl)silyl]-2,2-dimethyl-3-phenylpent-4-enoate (PubChem CID 101122467) has the molecular formula C20H32O2Si and a molecular weight of 332.56 g/mol. Its IUPAC name is methyl (E)-5-[tert-butyl(dimethyl)silyl]-2,2-dimethyl-3-phenylpent-4-enoate.
| Compound Name | methyl (E)-5-[tert-butyl(dimethyl)silyl]-2,2-dimethyl-3-phenylpent-4-enoate |
|---|---|
| PubChem CID | 101122467 |
| Molecular Formula | C20H32O2Si |
| Molecular Weight | 332.56 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | methyl (E)-5-[tert-butyl(dimethyl)silyl]-2,2-dimethyl-3-phenylpent-4-enoate |
| SMILES | COC(=O)C(C)(C)C(/C=C/[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C20H32O2Si/c1-19(2,3)23(7,8)15-14-17(16-12-10-9-11-13-16)20(4,5)18(21)22-6/h9-15,17H,1-8H3/b15-14+ |
| InChIKey | CQUCITCGNPYWGJ-CCEZHUSRSA-N |
| XLogP | 5.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.56 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|