C24H32N2O2 — CID 56837508
methyl (E)-3,5-bis[4-(dimethylamino)phenyl]-2,2-dimethylpent-4-enoate (PubChem CID 56837508) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is methyl (E)-3,5-bis[4-(dimethylamino)phenyl]-2,2-dimethylpent-4-enoate.
| Compound Name | methyl (E)-3,5-bis[4-(dimethylamino)phenyl]-2,2-dimethylpent-4-enoate |
|---|---|
| PubChem CID | 56837508 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | methyl (E)-3,5-bis[4-(dimethylamino)phenyl]-2,2-dimethylpent-4-enoate |
| SMILES | COC(=O)C(C)(C)C(/C=C/c1ccc(N(C)C)cc1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C24H32N2O2/c1-24(2,23(27)28-7)22(19-11-15-21(16-12-19)26(5)6)17-10-18-8-13-20(14-9-18)25(3)4/h8-17,22H,1-7H3/b17-10+ |
| InChIKey | BNIXJKOBTIYGHP-LICLKQGHSA-N |
| XLogP | 4.81 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|