C15H19NO3 — CID 54003610
methyl 5-[4-(dimethylamino)phenyl]-2-methoxypenta-2,4-dienoate (PubChem CID 54003610) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is methyl 5-[4-(dimethylamino)phenyl]-2-methoxypenta-2,4-dienoate.
| Compound Name | methyl 5-[4-(dimethylamino)phenyl]-2-methoxypenta-2,4-dienoate |
|---|---|
| PubChem CID | 54003610 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | methyl 5-[4-(dimethylamino)phenyl]-2-methoxypenta-2,4-dienoate |
| SMILES | COC(=O)C(=CC=Cc1ccc(N(C)C)cc1)OC |
| InChI | InChI=1S/C15H19NO3/c1-16(2)13-10-8-12(9-11-13)6-5-7-14(18-3)15(17)19-4/h5-11H,1-4H3 |
| InChIKey | KNHZNLWRJDHJEK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|