C14H22O2Si — CID 174920111
2,2-dimethyl-3-phenyl-3-trimethylsilylpropanoic acid (PubChem CID 174920111) has the molecular formula C14H22O2Si and a molecular weight of 250.41 g/mol. Its IUPAC name is 2,2-dimethyl-3-phenyl-3-trimethylsilylpropanoic acid.
| Compound Name | 2,2-dimethyl-3-phenyl-3-trimethylsilylpropanoic acid |
|---|---|
| PubChem CID | 174920111 |
| Molecular Formula | C14H22O2Si |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2,2-dimethyl-3-phenyl-3-trimethylsilylpropanoic acid |
| SMILES | CC(C)(C(=O)O)C(c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C14H22O2Si/c1-14(2,13(15)16)12(17(3,4)5)11-9-7-6-8-10-11/h6-10,12H,1-5H3,(H,15,16) |
| InChIKey | FDBAOZSFVVCSGF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|