C18H38O3Si2 — CID 138975448
(1-methoxy-3-trimethylsilyloxyundeca-1,3-dienoxy)-trimethylsilane (PubChem CID 138975448) has the molecular formula C18H38O3Si2 and a molecular weight of 358.67 g/mol. Its IUPAC name is (1-methoxy-3-trimethylsilyloxyundeca-1,3-dienoxy)-trimethylsilane.
| Compound Name | (1-methoxy-3-trimethylsilyloxyundeca-1,3-dienoxy)-trimethylsilane |
|---|---|
| PubChem CID | 138975448 |
| Molecular Formula | C18H38O3Si2 |
| Molecular Weight | 358.67 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | (1-methoxy-3-trimethylsilyloxyundeca-1,3-dienoxy)-trimethylsilane |
| SMILES | CCCCCCCC=C(C=C(OC)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C18H38O3Si2/c1-9-10-11-12-13-14-15-17(20-22(3,4)5)16-18(19-2)21-23(6,7)8/h15-16H,9-14H2,1-8H3 |
| InChIKey | MOWKQNMALTZUEB-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.67 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|