C13H28O3Si2 — CID 24858750
[(1E,3Z)-1-methoxy-3-trimethylsilyloxyhexa-1,3-dienoxy]-trimethylsilane (PubChem CID 24858750) has the molecular formula C13H28O3Si2 and a molecular weight of 288.54 g/mol. Its IUPAC name is [(1E,3Z)-1-methoxy-3-trimethylsilyloxyhexa-1,3-dienoxy]-trimethylsilane.
| Compound Name | [(1E,3Z)-1-methoxy-3-trimethylsilyloxyhexa-1,3-dienoxy]-trimethylsilane |
|---|---|
| PubChem CID | 24858750 |
| Molecular Formula | C13H28O3Si2 |
| Molecular Weight | 288.54 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | [(1E,3Z)-1-methoxy-3-trimethylsilyloxyhexa-1,3-dienoxy]-trimethylsilane |
| SMILES | CC/C=C(/C=C(\OC)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H28O3Si2/c1-9-10-12(15-17(3,4)5)11-13(14-2)16-18(6,7)8/h10-11H,9H2,1-8H3/b12-10-,13-11+ |
| InChIKey | CPBGOZSPTQTVSA-PJABCKPXSA-N |
| XLogP | 4.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|