C9H21NOSi — CID 87755173
(Z)-N,N-dimethyl-1-trimethylsilyloxybut-1-en-1-amine (PubChem CID 87755173) has the molecular formula C9H21NOSi and a molecular weight of 187.36 g/mol. Its IUPAC name is (Z)-N,N-dimethyl-1-trimethylsilyloxybut-1-en-1-amine.
| Compound Name | (Z)-N,N-dimethyl-1-trimethylsilyloxybut-1-en-1-amine |
|---|---|
| PubChem CID | 87755173 |
| Molecular Formula | C9H21NOSi |
| Molecular Weight | 187.36 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (Z)-N,N-dimethyl-1-trimethylsilyloxybut-1-en-1-amine |
| SMILES | CC/C=C(\O[Si](C)(C)C)N(C)C |
| InChI | InChI=1S/C9H21NOSi/c1-7-8-9(10(2)3)11-12(4,5)6/h8H,7H2,1-6H3/b9-8- |
| InChIKey | LJIUSKLPUGUWSQ-HJWRWDBZSA-N |
| XLogP | 2.65 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|