C21H36O2Si — CID 102376869
[(E)-3,3-bis(2-bicyclo[2.2.1]heptanyl)-1-methoxyprop-1-enoxy]-trimethylsilane (PubChem CID 102376869) has the molecular formula C21H36O2Si and a molecular weight of 348.60 g/mol. Its IUPAC name is [(E)-3,3-bis(2-bicyclo[2.2.1]heptanyl)-1-methoxyprop-1-enoxy]-trimethylsilane.
| Compound Name | [(E)-3,3-bis(2-bicyclo[2.2.1]heptanyl)-1-methoxyprop-1-enoxy]-trimethylsilane |
|---|---|
| PubChem CID | 102376869 |
| Molecular Formula | C21H36O2Si |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | [(E)-3,3-bis(2-bicyclo[2.2.1]heptanyl)-1-methoxyprop-1-enoxy]-trimethylsilane |
| SMILES | CO/C(=C\C(C1CC2CCC1C2)C1CC2CCC1C2)O[Si](C)(C)C |
| InChI | InChI=1S/C21H36O2Si/c1-22-21(23-24(2,3)4)13-20(18-11-14-5-7-16(18)9-14)19-12-15-6-8-17(19)10-15/h13-20H,5-12H2,1-4H3/b21-13+ |
| InChIKey | WTJSUULPKSFCFC-FYJGNVAPSA-N |
| XLogP | 5.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|