About bicyclo[2.2.1]heptan-2-ol;methoxy(trimethyl)silane
bicyclo[2.2.1]heptan-2-ol;methoxy(trimethyl)silane (PubChem CID 158307954) has the molecular formula C11H24O2Si
and a molecular weight of 216.40 g/mol. Its IUPAC name is bicyclo[2.2.1]heptan-2-ol;methoxy(trimethyl)silane.
Molecular Properties
| Compound Name | bicyclo[2.2.1]heptan-2-ol;methoxy(trimethyl)silane |
| PubChem CID | 158307954 |
| Molecular Formula | C11H24O2Si |
| Molecular Weight | 216.40 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | bicyclo[2.2.1]heptan-2-ol;methoxy(trimethyl)silane |
| SMILES | CO[Si](C)(C)C.OC1CC2CCC1C2 |
| InChI | InChI=1S/C7H12O.C4H12OSi/c8-7-4-5-1-2-6(7)3-5;1-5-6(2,3)4/h5-8H,1-4H2;1-4H3 |
| InChIKey | GNHZAKQLLHWEHT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]heptan-2-ol;methoxy(trimethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]heptan-2-ol;methoxy(trimethyl)silane?
The IUPAC name of bicyclo[2.2.1]heptan-2-ol;methoxy(trimethyl)silane (CID 158307954) is bicyclo[2.2.1]heptan-2-ol;methoxy(trimethyl)silane.
What is the SMILES notation for bicyclo[2.2.1]heptan-2-ol;methoxy(trimethyl)silane?
The canonical SMILES for bicyclo[2.2.1]heptan-2-ol;methoxy(trimethyl)silane is CO[Si](C)(C)C.OC1CC2CCC1C2.
What is the InChIKey of bicyclo[2.2.1]heptan-2-ol;methoxy(trimethyl)silane?
The InChIKey is GNHZAKQLLHWEHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O.C4H12OSi/c8-7-4-5-1-2-6(7)3-5;1-5-6(2,3)4/h5-8H,1-4H2;1-4H3.
What are the key properties of bicyclo[2.2.1]heptan-2-ol;methoxy(trimethyl)silane?
bicyclo[2.2.1]heptan-2-ol;methoxy(trimethyl)silane has a molecular weight of 216.40 g/mol, XLogP of 2.63, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]heptan-2-ol;methoxy(trimethyl)silane is sourced from PubChem (CID 158307954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).