C14H30O5Si2 — CID 90766534
acetic acid;2-bicyclo[2.2.1]heptanyl-methoxy-[methoxy(dimethyl)silyl]oxy-methylsilane (PubChem CID 90766534) has the molecular formula C14H30O5Si2 and a molecular weight of 334.56 g/mol. Its IUPAC name is acetic acid;2-bicyclo[2.2.1]heptanyl-methoxy-[methoxy(dimethyl)silyl]oxy-methylsilane.
| Compound Name | acetic acid;2-bicyclo[2.2.1]heptanyl-methoxy-[methoxy(dimethyl)silyl]oxy-methylsilane |
|---|---|
| PubChem CID | 90766534 |
| Molecular Formula | C14H30O5Si2 |
| Molecular Weight | 334.56 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | acetic acid;2-bicyclo[2.2.1]heptanyl-methoxy-[methoxy(dimethyl)silyl]oxy-methylsilane |
| SMILES | CC(=O)O.CO[Si](C)(C)O[Si](C)(OC)C1CC2CCC1C2 |
| InChI | InChI=1S/C12H26O3Si2.C2H4O2/c1-13-16(3,4)15-17(5,14-2)12-9-10-6-7-11(12)8-10;1-2(3)4/h10-12H,6-9H2,1-5H3;1H3,(H,3,4) |
| InChIKey | PLGFPOXTOMBUMO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.56 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|