About 2-bicyclo[2.2.1]heptanyl-ethynyl-dimethylsilane
2-bicyclo[2.2.1]heptanyl-ethynyl-dimethylsilane (PubChem CID 15050662) has the molecular formula C11H18Si
and a molecular weight of 178.35 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanyl-ethynyl-dimethylsilane.
Molecular Properties
| Compound Name | 2-bicyclo[2.2.1]heptanyl-ethynyl-dimethylsilane |
| PubChem CID | 15050662 |
| Molecular Formula | C11H18Si |
| Molecular Weight | 178.35 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanyl-ethynyl-dimethylsilane |
| SMILES | C#C[Si](C)(C)C1CC2CCC1C2 |
| InChI | InChI=1S/C11H18Si/c1-4-12(2,3)11-8-9-5-6-10(11)7-9/h1,9-11H,5-8H2,2-3H3 |
| InChIKey | GTMUKPUTQQPNIN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bicyclo[2.2.1]heptanyl-ethynyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bicyclo[2.2.1]heptanyl-ethynyl-dimethylsilane?
The IUPAC name of 2-bicyclo[2.2.1]heptanyl-ethynyl-dimethylsilane (CID 15050662) is 2-bicyclo[2.2.1]heptanyl-ethynyl-dimethylsilane.
What is the SMILES notation for 2-bicyclo[2.2.1]heptanyl-ethynyl-dimethylsilane?
The canonical SMILES for 2-bicyclo[2.2.1]heptanyl-ethynyl-dimethylsilane is C#C[Si](C)(C)C1CC2CCC1C2.
What is the InChIKey of 2-bicyclo[2.2.1]heptanyl-ethynyl-dimethylsilane?
The InChIKey is GTMUKPUTQQPNIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18Si/c1-4-12(2,3)11-8-9-5-6-10(11)7-9/h1,9-11H,5-8H2,2-3H3.
What are the key properties of 2-bicyclo[2.2.1]heptanyl-ethynyl-dimethylsilane?
2-bicyclo[2.2.1]heptanyl-ethynyl-dimethylsilane has a molecular weight of 178.35 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bicyclo[2.2.1]heptanyl-ethynyl-dimethylsilane is sourced from PubChem (CID 15050662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).