About bicyclo[2.2.1]heptane-2-carbonitrile;tetramethylsilane
bicyclo[2.2.1]heptane-2-carbonitrile;tetramethylsilane (PubChem CID 90949239) has the molecular formula C12H23NSi
and a molecular weight of 209.41 g/mol. Its IUPAC name is bicyclo[2.2.1]heptane-2-carbonitrile;tetramethylsilane.
Molecular Properties
| Compound Name | bicyclo[2.2.1]heptane-2-carbonitrile;tetramethylsilane |
| PubChem CID | 90949239 |
| Molecular Formula | C12H23NSi |
| Molecular Weight | 209.41 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | bicyclo[2.2.1]heptane-2-carbonitrile;tetramethylsilane |
| SMILES | C[Si](C)(C)C.N#CC1CC2CCC1C2 |
| InChI | InChI=1S/C8H11N.C4H12Si/c9-5-8-4-6-1-2-7(8)3-6;1-5(2,3)4/h6-8H,1-4H2;1-4H3 |
| InChIKey | YRVHPZOYRNRVSI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]heptane-2-carbonitrile;tetramethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]heptane-2-carbonitrile;tetramethylsilane?
The IUPAC name of bicyclo[2.2.1]heptane-2-carbonitrile;tetramethylsilane (CID 90949239) is bicyclo[2.2.1]heptane-2-carbonitrile;tetramethylsilane.
What is the SMILES notation for bicyclo[2.2.1]heptane-2-carbonitrile;tetramethylsilane?
The canonical SMILES for bicyclo[2.2.1]heptane-2-carbonitrile;tetramethylsilane is C[Si](C)(C)C.N#CC1CC2CCC1C2.
What is the InChIKey of bicyclo[2.2.1]heptane-2-carbonitrile;tetramethylsilane?
The InChIKey is YRVHPZOYRNRVSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C4H12Si/c9-5-8-4-6-1-2-7(8)3-6;1-5(2,3)4/h6-8H,1-4H2;1-4H3.
What are the key properties of bicyclo[2.2.1]heptane-2-carbonitrile;tetramethylsilane?
bicyclo[2.2.1]heptane-2-carbonitrile;tetramethylsilane has a molecular weight of 209.41 g/mol, XLogP of 3.90, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]heptane-2-carbonitrile;tetramethylsilane is sourced from PubChem (CID 90949239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).