C15H29P — CID 124674169
[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-ditert-butylphosphane (PubChem CID 124674169) has the molecular formula C15H29P and a molecular weight of 240.37 g/mol. Its IUPAC name is [(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-ditert-butylphosphane.
| Compound Name | [(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-ditert-butylphosphane |
|---|---|
| PubChem CID | 124674169 |
| Molecular Formula | C15H29P |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | [(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-ditert-butylphosphane |
| SMILES | CC(C)(C)P([C@@H]1C[C@@H]2CC[C@H]1C2)C(C)(C)C |
| InChI | InChI=1S/C15H29P/c1-14(2,3)16(15(4,5)6)13-10-11-7-8-12(13)9-11/h11-13H,7-10H2,1-6H3/t11-,12+,13-/m1/s1 |
| InChIKey | KLQDTSDJWQAGBD-FRRDWIJNSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|