C9H17O2P — CID 131858461
[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-dimethoxyphosphane (PubChem CID 131858461) has the molecular formula C9H17O2P and a molecular weight of 188.21 g/mol. Its IUPAC name is [(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-dimethoxyphosphane.
| Compound Name | [(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-dimethoxyphosphane |
|---|---|
| PubChem CID | 131858461 |
| Molecular Formula | C9H17O2P |
| Molecular Weight | 188.21 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | [(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl]-dimethoxyphosphane |
| SMILES | COP(OC)[C@@H]1C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C9H17O2P/c1-10-12(11-2)9-6-7-3-4-8(9)5-7/h7-9H,3-6H2,1-2H3/t7-,8+,9-/m1/s1 |
| InChIKey | FJMHJMNYRKMULI-HRDYMLBCSA-N |
| XLogP | 2.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|