C25H52OSi3 — CID 134945498
triethyl-[(2E)-1-prop-2-enyl-3-triethylsilyl-5-(trimethylsilylmethyl)hexa-2,5-dienoxy]silane (PubChem CID 134945498) has the molecular formula C25H52OSi3 and a molecular weight of 452.95 g/mol. Its IUPAC name is triethyl-[(2E)-1-prop-2-enyl-3-triethylsilyl-5-(trimethylsilylmethyl)hexa-2,5-dienoxy]silane.
| Compound Name | triethyl-[(2E)-1-prop-2-enyl-3-triethylsilyl-5-(trimethylsilylmethyl)hexa-2,5-dienoxy]silane |
|---|---|
| PubChem CID | 134945498 |
| Molecular Formula | C25H52OSi3 |
| Molecular Weight | 452.95 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | triethyl-[(2E)-1-prop-2-enyl-3-triethylsilyl-5-(trimethylsilylmethyl)hexa-2,5-dienoxy]silane |
| SMILES | C=CCC(/C=C(\CC(=C)C[Si](C)(C)C)[Si](CC)(CC)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C25H52OSi3/c1-12-19-24(26-29(16-5,17-6)18-7)21-25(28(13-2,14-3)15-4)20-23(8)22-27(9,10)11/h12,21,24H,1,8,13-20,22H2,2-7,9-11H3/b25-21+ |
| InChIKey | LSRMYEYNABINBU-NJNXFGOHSA-N |
| XLogP | 9.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.95 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|