C12H25BrOSi — CID 174411016
[(E)-6-bromohex-3-en-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 174411016) has the molecular formula C12H25BrOSi and a molecular weight of 293.32 g/mol. Its IUPAC name is [(E)-6-bromohex-3-en-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(E)-6-bromohex-3-en-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 174411016 |
| Molecular Formula | C12H25BrOSi |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | [(E)-6-bromohex-3-en-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(/C=C/CCBr)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H25BrOSi/c1-11(9-7-8-10-13)14-15(5,6)12(2,3)4/h7,9,11H,8,10H2,1-6H3/b9-7+ |
| InChIKey | HJMKLXCUKFKOKB-VQHVLOKHSA-N |
| XLogP | 4.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|