C24H44O3Si — CID 100938118
(9Z,12Z,15Z)-17-[tert-butyl(dimethyl)silyl]oxyoctadeca-9,12,15-trienoic acid (PubChem CID 100938118) has the molecular formula C24H44O3Si and a molecular weight of 408.70 g/mol. Its IUPAC name is (9Z,12Z,15Z)-17-[tert-butyl(dimethyl)silyl]oxyoctadeca-9,12,15-trienoic acid.
| Compound Name | (9Z,12Z,15Z)-17-[tert-butyl(dimethyl)silyl]oxyoctadeca-9,12,15-trienoic acid |
|---|---|
| PubChem CID | 100938118 |
| Molecular Formula | C24H44O3Si |
| Molecular Weight | 408.70 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | (9Z,12Z,15Z)-17-[tert-butyl(dimethyl)silyl]oxyoctadeca-9,12,15-trienoic acid |
| SMILES | CC(/C=C\C/C=C\C/C=C\CCCCCCCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H44O3Si/c1-22(27-28(5,6)24(2,3)4)20-18-16-14-12-10-8-7-9-11-13-15-17-19-21-23(25)26/h7-8,12,14,18,20,22H,9-11,13,15-17,19,21H2,1-6H3,(H,25,26)/b8-7-,14-12-,20-18- |
| InChIKey | OPIQVVSNTKLQCC-CVAOBTGHSA-N |
| XLogP | 7.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.70 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|