C18H32O4 — CID 140675774
(9Z,12Z)-17,17-dihydroxyoctadeca-9,12-dienoic acid (PubChem CID 140675774) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is (9Z,12Z)-17,17-dihydroxyoctadeca-9,12-dienoic acid.
| Compound Name | (9Z,12Z)-17,17-dihydroxyoctadeca-9,12-dienoic acid |
|---|---|
| PubChem CID | 140675774 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | (9Z,12Z)-17,17-dihydroxyoctadeca-9,12-dienoic acid |
| SMILES | CC(O)(O)CCC/C=C\C/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H32O4/c1-18(21,22)16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-17(19)20/h2,4,8,10,21-22H,3,5-7,9,11-16H2,1H3,(H,19,20)/b4-2-,10-8- |
| InChIKey | RCXNACCIWGDKTK-VBFFHFTGSA-N |
| XLogP | 4.18 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|