C19H29BrOSi — CID 163676160
(6-bromo-2,3-dihydronaphthalen-2-yl)oxy-tri(propan-2-yl)silane (PubChem CID 163676160) has the molecular formula C19H29BrOSi and a molecular weight of 381.43 g/mol. Its IUPAC name is (6-bromo-2,3-dihydronaphthalen-2-yl)oxy-tri(propan-2-yl)silane.
| Compound Name | (6-bromo-2,3-dihydronaphthalen-2-yl)oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 163676160 |
| Molecular Formula | C19H29BrOSi |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | (6-bromo-2,3-dihydronaphthalen-2-yl)oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC1C=c2ccc(Br)cc2=CC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H29BrOSi/c1-13(2)22(14(3)4,15(5)6)21-19-10-8-16-11-18(20)9-7-17(16)12-19/h7-9,11-15,19H,10H2,1-6H3 |
| InChIKey | JGXBFAQICADQKF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|