C13H23BrOSi — CID 151749783
(6-bromo-6-methylcyclohexa-2,4-dien-1-yl)oxy-tert-butyl-dimethylsilane (PubChem CID 151749783) has the molecular formula C13H23BrOSi and a molecular weight of 303.32 g/mol. Its IUPAC name is (6-bromo-6-methylcyclohexa-2,4-dien-1-yl)oxy-tert-butyl-dimethylsilane.
| Compound Name | (6-bromo-6-methylcyclohexa-2,4-dien-1-yl)oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 151749783 |
| Molecular Formula | C13H23BrOSi |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | (6-bromo-6-methylcyclohexa-2,4-dien-1-yl)oxy-tert-butyl-dimethylsilane |
| SMILES | CC1(Br)C=CC=CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H23BrOSi/c1-12(2,3)16(5,6)15-11-9-7-8-10-13(11,4)14/h7-11H,1-6H3 |
| InChIKey | ROGVLDXDTNGRNU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|