C16H29BrOSi — CID 11152147
[(Z,2S)-4-bromo-4-(cyclohexen-1-yl)but-3-en-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11152147) has the molecular formula C16H29BrOSi and a molecular weight of 345.40 g/mol. Its IUPAC name is [(Z,2S)-4-bromo-4-(cyclohexen-1-yl)but-3-en-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(Z,2S)-4-bromo-4-(cyclohexen-1-yl)but-3-en-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11152147 |
| Molecular Formula | C16H29BrOSi |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [(Z,2S)-4-bromo-4-(cyclohexen-1-yl)but-3-en-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@@H](/C=C(\Br)C1=CCCCC1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H29BrOSi/c1-13(18-19(5,6)16(2,3)4)12-15(17)14-10-8-7-9-11-14/h10,12-13H,7-9,11H2,1-6H3/b15-12-/t13-/m0/s1 |
| InChIKey | AUZODDHBFYXEGX-FRRXJZEGSA-N |
| XLogP | 6.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|