C17H33BrOSi — CID 101267050
[(2E,4Z)-4-bromoundeca-2,4-dienoxy]-tert-butyl-dimethylsilane (PubChem CID 101267050) has the molecular formula C17H33BrOSi and a molecular weight of 361.44 g/mol. Its IUPAC name is [(2E,4Z)-4-bromoundeca-2,4-dienoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2E,4Z)-4-bromoundeca-2,4-dienoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101267050 |
| Molecular Formula | C17H33BrOSi |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [(2E,4Z)-4-bromoundeca-2,4-dienoxy]-tert-butyl-dimethylsilane |
| SMILES | CCCCCC/C=C(Br)/C=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H33BrOSi/c1-7-8-9-10-11-13-16(18)14-12-15-19-20(5,6)17(2,3)4/h12-14H,7-11,15H2,1-6H3/b14-12+,16-13- |
| InChIKey | OEYWWSQPYULBDM-QLKCLSONSA-N |
| XLogP | 6.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|