C19H37BrOSi — CID 101267046
[(2R,3Z,5E)-4-bromo-2-methyldodeca-3,5-dienoxy]-tert-butyl-dimethylsilane (PubChem CID 101267046) has the molecular formula C19H37BrOSi and a molecular weight of 389.49 g/mol. Its IUPAC name is [(2R,3Z,5E)-4-bromo-2-methyldodeca-3,5-dienoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3Z,5E)-4-bromo-2-methyldodeca-3,5-dienoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101267046 |
| Molecular Formula | C19H37BrOSi |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | [(2R,3Z,5E)-4-bromo-2-methyldodeca-3,5-dienoxy]-tert-butyl-dimethylsilane |
| SMILES | CCCCCC/C=C/C(Br)=C/[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H37BrOSi/c1-8-9-10-11-12-13-14-18(20)15-17(2)16-21-22(6,7)19(3,4)5/h13-15,17H,8-12,16H2,1-7H3/b14-13+,18-15-/t17-/m1/s1 |
| InChIKey | BXRDOQQOGNXHCE-XLRBFZIDSA-N |
| XLogP | 7.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|