C20H40OSi — CID 134982103
tert-butyl-[(2S,3E,5E)-2,4-dimethyldodeca-3,5-dienoxy]-dimethylsilane (PubChem CID 134982103) has the molecular formula C20H40OSi and a molecular weight of 324.62 g/mol. Its IUPAC name is tert-butyl-[(2S,3E,5E)-2,4-dimethyldodeca-3,5-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3E,5E)-2,4-dimethyldodeca-3,5-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134982103 |
| Molecular Formula | C20H40OSi |
| Molecular Weight | 324.62 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | tert-butyl-[(2S,3E,5E)-2,4-dimethyldodeca-3,5-dienoxy]-dimethylsilane |
| SMILES | CCCCCC/C=C/C(C)=C/[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40OSi/c1-9-10-11-12-13-14-15-18(2)16-19(3)17-21-22(7,8)20(4,5)6/h14-16,19H,9-13,17H2,1-8H3/b15-14+,18-16+/t19-/m0/s1 |
| InChIKey | MAINBSPRZAUJCN-ZGJDQKGJSA-N |
| XLogP | 7.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.62 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|