C19H36OSi2 — CID 101267042
tert-butyl-[(2R,3Z,5E)-2,4-dimethyl-8-trimethylsilylocta-3,5-dien-7-ynoxy]-dimethylsilane (PubChem CID 101267042) has the molecular formula C19H36OSi2 and a molecular weight of 336.67 g/mol. Its IUPAC name is tert-butyl-[(2R,3Z,5E)-2,4-dimethyl-8-trimethylsilylocta-3,5-dien-7-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3Z,5E)-2,4-dimethyl-8-trimethylsilylocta-3,5-dien-7-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101267042 |
| Molecular Formula | C19H36OSi2 |
| Molecular Weight | 336.67 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | tert-butyl-[(2R,3Z,5E)-2,4-dimethyl-8-trimethylsilylocta-3,5-dien-7-ynoxy]-dimethylsilane |
| SMILES | CC(=C/[C@@H](C)CO[Si](C)(C)C(C)(C)C)/C=C/C#C[Si](C)(C)C |
| InChI | InChI=1S/C19H36OSi2/c1-17(13-11-12-14-21(6,7)8)15-18(2)16-20-22(9,10)19(3,4)5/h11,13,15,18H,16H2,1-10H3/b13-11+,17-15-/t18-/m1/s1 |
| InChIKey | CJEQRGSFQREJNP-FROCAJNMSA-N |
| XLogP | 6.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.67 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|