C18H36OSi — CID 101267045
tert-butyl-[(2R,3Z,5E)-2,4-dimethyldeca-3,5-dienoxy]-dimethylsilane (PubChem CID 101267045) has the molecular formula C18H36OSi and a molecular weight of 296.57 g/mol. Its IUPAC name is tert-butyl-[(2R,3Z,5E)-2,4-dimethyldeca-3,5-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3Z,5E)-2,4-dimethyldeca-3,5-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101267045 |
| Molecular Formula | C18H36OSi |
| Molecular Weight | 296.57 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | tert-butyl-[(2R,3Z,5E)-2,4-dimethyldeca-3,5-dienoxy]-dimethylsilane |
| SMILES | CCCC/C=C/C(C)=C\[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36OSi/c1-9-10-11-12-13-16(2)14-17(3)15-19-20(7,8)18(4,5)6/h12-14,17H,9-11,15H2,1-8H3/b13-12+,16-14-/t17-/m1/s1 |
| InChIKey | DOLWJKFSAPYMSS-YZZDQZOSSA-N |
| XLogP | 6.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.57 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|