C17H33BrOSi — CID 11325899
[(2R,3Z,5E)-4-bromo-2-methyldeca-3,5-dienoxy]-tert-butyl-dimethylsilane (PubChem CID 11325899) has the molecular formula C17H33BrOSi and a molecular weight of 361.44 g/mol. Its IUPAC name is [(2R,3Z,5E)-4-bromo-2-methyldeca-3,5-dienoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3Z,5E)-4-bromo-2-methyldeca-3,5-dienoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11325899 |
| Molecular Formula | C17H33BrOSi |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [(2R,3Z,5E)-4-bromo-2-methyldeca-3,5-dienoxy]-tert-butyl-dimethylsilane |
| SMILES | CCCC/C=C/C(Br)=C/[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H33BrOSi/c1-8-9-10-11-12-16(18)13-15(2)14-19-20(6,7)17(3,4)5/h11-13,15H,8-10,14H2,1-7H3/b12-11+,16-13-/t15-/m1/s1 |
| InChIKey | KXIMQPUOKZSQED-HTSYCHFGSA-N |
| XLogP | 6.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|