C18H33BrOSi2 — CID 11475115
[(3E,5Z,7R)-5-bromo-8-[tert-butyl(dimethyl)silyl]oxy-7-methylocta-3,5-dien-1-ynyl]-trimethylsilane (PubChem CID 11475115) has the molecular formula C18H33BrOSi2 and a molecular weight of 401.54 g/mol. Its IUPAC name is [(3E,5Z,7R)-5-bromo-8-[tert-butyl(dimethyl)silyl]oxy-7-methylocta-3,5-dien-1-ynyl]-trimethylsilane.
| Compound Name | [(3E,5Z,7R)-5-bromo-8-[tert-butyl(dimethyl)silyl]oxy-7-methylocta-3,5-dien-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 11475115 |
| Molecular Formula | C18H33BrOSi2 |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | [(3E,5Z,7R)-5-bromo-8-[tert-butyl(dimethyl)silyl]oxy-7-methylocta-3,5-dien-1-ynyl]-trimethylsilane |
| SMILES | C[C@H](/C=C(Br)/C=C/C#C[Si](C)(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H33BrOSi2/c1-16(15-20-22(8,9)18(2,3)4)14-17(19)12-10-11-13-21(5,6)7/h10,12,14,16H,15H2,1-9H3/b12-10+,17-14-/t16-/m1/s1 |
| InChIKey | FBFRNRKSWAFUQH-TWQCNNRISA-N |
| XLogP | 6.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|