C19H30OSi — CID 11220389
tert-butyl-dimethyl-[(2S,3E,5E,7E,9E)-2-methyldodeca-3,5,7,9-tetraen-11-ynoxy]silane (PubChem CID 11220389) has the molecular formula C19H30OSi and a molecular weight of 302.53 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2S,3E,5E,7E,9E)-2-methyldodeca-3,5,7,9-tetraen-11-ynoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2S,3E,5E,7E,9E)-2-methyldodeca-3,5,7,9-tetraen-11-ynoxy]silane |
|---|---|
| PubChem CID | 11220389 |
| Molecular Formula | C19H30OSi |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | tert-butyl-dimethyl-[(2S,3E,5E,7E,9E)-2-methyldodeca-3,5,7,9-tetraen-11-ynoxy]silane |
| SMILES | C#C/C=C/C=C/C=C/C=C/[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H30OSi/c1-8-9-10-11-12-13-14-15-16-18(2)17-20-21(6,7)19(3,4)5/h1,9-16,18H,17H2,2-7H3/b10-9+,12-11+,14-13+,16-15+/t18-/m0/s1 |
| InChIKey | YAZZSBFHCXGFPW-KSQGAUQGSA-N |
| XLogP | 5.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|