C18H28OSi — CID 134887388
tert-butyl-[(3E,5E,7E,9E)-dodeca-3,5,7,9-tetraen-11-ynoxy]-dimethylsilane (PubChem CID 134887388) has the molecular formula C18H28OSi and a molecular weight of 288.51 g/mol. Its IUPAC name is tert-butyl-[(3E,5E,7E,9E)-dodeca-3,5,7,9-tetraen-11-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3E,5E,7E,9E)-dodeca-3,5,7,9-tetraen-11-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134887388 |
| Molecular Formula | C18H28OSi |
| Molecular Weight | 288.51 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | tert-butyl-[(3E,5E,7E,9E)-dodeca-3,5,7,9-tetraen-11-ynoxy]-dimethylsilane |
| SMILES | C#C/C=C/C=C/C=C/C=C/CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H28OSi/c1-7-8-9-10-11-12-13-14-15-16-17-19-20(5,6)18(2,3)4/h1,8-15H,16-17H2,2-6H3/b9-8+,11-10+,13-12+,15-14+ |
| InChIKey | YKVSXDPUQKIAAC-SRGMUBKESA-N |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|