C15H26OSi — CID 11345720
tert-butyl-dimethyl-[(2S,3E,5E)-2-methylocta-3,5-dien-7-ynoxy]silane (PubChem CID 11345720) has the molecular formula C15H26OSi and a molecular weight of 250.46 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2S,3E,5E)-2-methylocta-3,5-dien-7-ynoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2S,3E,5E)-2-methylocta-3,5-dien-7-ynoxy]silane |
|---|---|
| PubChem CID | 11345720 |
| Molecular Formula | C15H26OSi |
| Molecular Weight | 250.46 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | tert-butyl-dimethyl-[(2S,3E,5E)-2-methylocta-3,5-dien-7-ynoxy]silane |
| SMILES | C#C/C=C/C=C/[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H26OSi/c1-8-9-10-11-12-14(2)13-16-17(6,7)15(3,4)5/h1,9-12,14H,13H2,2-7H3/b10-9+,12-11+/t14-/m0/s1 |
| InChIKey | NHNMXOBNYNXRFS-YATWOAAGSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|