C20H34OSi2 — CID 11336947
tert-butyl-[(2R,3Z,5E)-4-ethynyl-2-methyl-8-trimethylsilylocta-3,5-dien-7-ynoxy]-dimethylsilane (PubChem CID 11336947) has the molecular formula C20H34OSi2 and a molecular weight of 346.66 g/mol. Its IUPAC name is tert-butyl-[(2R,3Z,5E)-4-ethynyl-2-methyl-8-trimethylsilylocta-3,5-dien-7-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3Z,5E)-4-ethynyl-2-methyl-8-trimethylsilylocta-3,5-dien-7-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11336947 |
| Molecular Formula | C20H34OSi2 |
| Molecular Weight | 346.66 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | tert-butyl-[(2R,3Z,5E)-4-ethynyl-2-methyl-8-trimethylsilylocta-3,5-dien-7-ynoxy]-dimethylsilane |
| SMILES | C#CC(=C\[C@@H](C)CO[Si](C)(C)C(C)(C)C)/C=C/C#C[Si](C)(C)C |
| InChI | InChI=1S/C20H34OSi2/c1-11-19(14-12-13-15-22(6,7)8)16-18(2)17-21-23(9,10)20(3,4)5/h1,12,14,16,18H,17H2,2-10H3/b14-12+,19-16+/t18-/m1/s1 |
| InChIKey | NIYGPYPCTPATRM-NLKRLBMYSA-N |
| XLogP | 5.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.66 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|