C21H40OSi2 — CID 11653482
tert-butyl-[(2E,4Z,6R)-4-ethyl-6-methyl-9-trimethylsilylnona-2,4-dien-8-ynoxy]-dimethylsilane (PubChem CID 11653482) has the molecular formula C21H40OSi2 and a molecular weight of 364.72 g/mol. Its IUPAC name is tert-butyl-[(2E,4Z,6R)-4-ethyl-6-methyl-9-trimethylsilylnona-2,4-dien-8-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E,4Z,6R)-4-ethyl-6-methyl-9-trimethylsilylnona-2,4-dien-8-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11653482 |
| Molecular Formula | C21H40OSi2 |
| Molecular Weight | 364.72 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | tert-butyl-[(2E,4Z,6R)-4-ethyl-6-methyl-9-trimethylsilylnona-2,4-dien-8-ynoxy]-dimethylsilane |
| SMILES | CCC(=C/[C@H](C)CC#C[Si](C)(C)C)/C=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40OSi2/c1-11-20(18-19(2)14-13-17-23(6,7)8)15-12-16-22-24(9,10)21(3,4)5/h12,15,18-19H,11,14,16H2,1-10H3/b15-12+,20-18-/t19-/m1/s1 |
| InChIKey | FJKMDOFPLQGJMI-OBQPOMCRSA-N |
| XLogP | 6.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.72 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|