C17H32OSi2 — CID 134887399
tert-butyl-dimethyl-[(2E,4Z)-4-methyl-7-trimethylsilylhepta-2,4-dien-6-ynoxy]silane (PubChem CID 134887399) has the molecular formula C17H32OSi2 and a molecular weight of 308.61 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2E,4Z)-4-methyl-7-trimethylsilylhepta-2,4-dien-6-ynoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2E,4Z)-4-methyl-7-trimethylsilylhepta-2,4-dien-6-ynoxy]silane |
|---|---|
| PubChem CID | 134887399 |
| Molecular Formula | C17H32OSi2 |
| Molecular Weight | 308.61 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | tert-butyl-dimethyl-[(2E,4Z)-4-methyl-7-trimethylsilylhepta-2,4-dien-6-ynoxy]silane |
| SMILES | CC(=C/C#C[Si](C)(C)C)/C=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32OSi2/c1-16(13-11-15-19(5,6)7)12-10-14-18-20(8,9)17(2,3)4/h10,12-13H,14H2,1-9H3/b12-10+,16-13- |
| InChIKey | JBMLIKKFICSKDS-YCNRLPBWSA-N |
| XLogP | 5.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.61 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|