C25H44OSi2 — CID 134939492
tert-butyl-[(2S,3Z,5E,7E,9E)-12-[tert-butyl(dimethyl)silyl]-2-methyldodeca-3,5,7,9-tetraen-11-ynoxy]-dimethylsilane (PubChem CID 134939492) has the molecular formula C25H44OSi2 and a molecular weight of 416.80 g/mol. Its IUPAC name is tert-butyl-[(2S,3Z,5E,7E,9E)-12-[tert-butyl(dimethyl)silyl]-2-methyldodeca-3,5,7,9-tetraen-11-ynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3Z,5E,7E,9E)-12-[tert-butyl(dimethyl)silyl]-2-methyldodeca-3,5,7,9-tetraen-11-ynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134939492 |
| Molecular Formula | C25H44OSi2 |
| Molecular Weight | 416.80 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | tert-butyl-[(2S,3Z,5E,7E,9E)-12-[tert-butyl(dimethyl)silyl]-2-methyldodeca-3,5,7,9-tetraen-11-ynoxy]-dimethylsilane |
| SMILES | C[C@@H](/C=C\C=C\C=C\C=C\C#C[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H44OSi2/c1-23(22-26-28(10,11)25(5,6)7)20-18-16-14-12-13-15-17-19-21-27(8,9)24(2,3)4/h12-18,20,23H,22H2,1-11H3/b13-12+,16-14+,17-15+,20-18-/t23-/m0/s1 |
| InChIKey | BTUHLDHFVAEQPC-FAZUEVGDSA-N |
| XLogP | 7.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.80 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|