C17H34OSi — CID 134993427
tert-butyl-dimethyl-[(2E,4Z)-2,4,6-trimethylocta-2,4-dienoxy]silane (PubChem CID 134993427) has the molecular formula C17H34OSi and a molecular weight of 282.54 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2E,4Z)-2,4,6-trimethylocta-2,4-dienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2E,4Z)-2,4,6-trimethylocta-2,4-dienoxy]silane |
|---|---|
| PubChem CID | 134993427 |
| Molecular Formula | C17H34OSi |
| Molecular Weight | 282.54 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | tert-butyl-dimethyl-[(2E,4Z)-2,4,6-trimethylocta-2,4-dienoxy]silane |
| SMILES | CCC(C)/C=C(C)\C=C(/C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34OSi/c1-10-14(2)11-15(3)12-16(4)13-18-19(8,9)17(5,6)7/h11-12,14H,10,13H2,1-9H3/b15-11-,16-12+ |
| InChIKey | RDDYXFKLAMZODY-UKVBVZPVSA-N |
| XLogP | 5.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.54 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|