C27H56OSiSn — CID 24865146
tert-butyl-dimethyl-[(2E,5S)-5-methyl-7-tributylstannylocta-2,7-dienoxy]silane (PubChem CID 24865146) has the molecular formula C27H56OSiSn and a molecular weight of 543.54 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2E,5S)-5-methyl-7-tributylstannylocta-2,7-dienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2E,5S)-5-methyl-7-tributylstannylocta-2,7-dienoxy]silane |
|---|---|
| PubChem CID | 24865146 |
| Molecular Formula | C27H56OSiSn |
| Molecular Weight | 543.54 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | tert-butyl-dimethyl-[(2E,5S)-5-methyl-7-tributylstannylocta-2,7-dienoxy]silane |
| SMILES | C=C(C[C@@H](C)C/C=C/CO[Si](C)(C)C(C)(C)C)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C15H29OSi.3C4H9.Sn/c1-8-11-14(2)12-9-10-13-16-17(6,7)15(3,4)5;3*1-3-4-2;/h9-10,14H,1,11-13H2,2-7H3;3*1,3-4H2,2H3;/b10-9+;;;;/t14-;;;;/m1..../s1 |
| InChIKey | WLFIUEOVOLFRQQ-BXGUSKIPSA-N |
| XLogP | 9.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.54 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|