C17H31IOSi — CID 11718394
tert-butyl-[(2E,6E,8E)-9-iodo-2,8-dimethylnona-2,6,8-trienoxy]-dimethylsilane (PubChem CID 11718394) has the molecular formula C17H31IOSi and a molecular weight of 406.42 g/mol. Its IUPAC name is tert-butyl-[(2E,6E,8E)-9-iodo-2,8-dimethylnona-2,6,8-trienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E,6E,8E)-9-iodo-2,8-dimethylnona-2,6,8-trienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11718394 |
| Molecular Formula | C17H31IOSi |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | tert-butyl-[(2E,6E,8E)-9-iodo-2,8-dimethylnona-2,6,8-trienoxy]-dimethylsilane |
| SMILES | CC(/C=C/CC/C=C(\C)CO[Si](C)(C)C(C)(C)C)=C\I |
| InChI | InChI=1S/C17H31IOSi/c1-15(13-18)11-9-8-10-12-16(2)14-19-20(6,7)17(3,4)5/h9,11-13H,8,10,14H2,1-7H3/b11-9+,15-13+,16-12+ |
| InChIKey | KZSQEALULOHWLE-YAZNSWJHSA-N |
| XLogP | 6.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|